C45H33N5O9 — CID 123975042
2-[4-[[(2-acetylquinolin-8-yl)amino]methyl]-3-amino-5-[[(2-methoxycarbonylquinolin-8-yl)amino]methyl]-6-oxoxanthen-9-yl]benzoic acid;carbon dioxide (PubChem CID 123975042) has the molecular formula C45H33N5O9 and a molecular weight of 787.79 g/mol. Its IUPAC name is 2-[4-[[(2-acetylquinolin-8-yl)amino]methyl]-3-amino-5-[[(2-methoxycarbonylquinolin-8-yl)amino]methyl]-6-oxoxanthen-9-yl]benzoic acid;carbon dioxide.
| Compound Name | 2-[4-[[(2-acetylquinolin-8-yl)amino]methyl]-3-amino-5-[[(2-methoxycarbonylquinolin-8-yl)amino]methyl]-6-oxoxanthen-9-yl]benzoic acid;carbon dioxide |
|---|---|
| PubChem CID | 123975042 |
| Molecular Formula | C45H33N5O9 |
| Molecular Weight | 787.79 g/mol |
| Exact Mass | 787.23 |
| IUPAC Name | 2-[4-[[(2-acetylquinolin-8-yl)amino]methyl]-3-amino-5-[[(2-methoxycarbonylquinolin-8-yl)amino]methyl]-6-oxoxanthen-9-yl]benzoic acid;carbon dioxide |
| SMILES | COC(=O)c1ccc2cccc(NCc3c4oc5c(CNc6cccc7ccc(C(C)=O)nc67)c(N)ccc5c(-c5ccccc5C(=O)O)c-4ccc3=O)c2n1.O=C=O |
| InChI | InChI=1S/C44H33N5O7.CO2/c1-23(50)33-18-13-24-7-5-11-34(39(24)48-33)46-21-30-32(45)17-15-28-38(26-9-3-4-10-27(26)43(52)53)29-16-20-37(51)31(42(29)56-41(28)30)22-47-35-12-6-8-25-14-19-36(44(54)55-2)49-40(25)35;2-1-3/h3-20,46-47H,21-22,45H2,1-2H3,(H,52,53); |
| InChIKey | DKTGCRDDGYCXQJ-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 220.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.79 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|