C45H31ClN4O10 — CID 123719579
2-[5-[[(2-acetylquinolin-8-yl)amino]methyl]-2-chloro-3-hydroxy-4-[[(2-methoxycarbonylquinolin-8-yl)amino]methyl]-6-oxoxanthen-9-yl]benzoic acid;carbon dioxide (PubChem CID 123719579) has the molecular formula C45H31ClN4O10 and a molecular weight of 823.21 g/mol. Its IUPAC name is 2-[5-[[(2-acetylquinolin-8-yl)amino]methyl]-2-chloro-3-hydroxy-4-[[(2-methoxycarbonylquinolin-8-yl)amino]methyl]-6-oxoxanthen-9-yl]benzoic acid;carbon dioxide.
| Compound Name | 2-[5-[[(2-acetylquinolin-8-yl)amino]methyl]-2-chloro-3-hydroxy-4-[[(2-methoxycarbonylquinolin-8-yl)amino]methyl]-6-oxoxanthen-9-yl]benzoic acid;carbon dioxide |
|---|---|
| PubChem CID | 123719579 |
| Molecular Formula | C45H31ClN4O10 |
| Molecular Weight | 823.21 g/mol |
| Exact Mass | 822.17 |
| IUPAC Name | 2-[5-[[(2-acetylquinolin-8-yl)amino]methyl]-2-chloro-3-hydroxy-4-[[(2-methoxycarbonylquinolin-8-yl)amino]methyl]-6-oxoxanthen-9-yl]benzoic acid;carbon dioxide |
| SMILES | COC(=O)c1ccc2cccc(NCc3c(O)c(Cl)cc4c(-c5ccccc5C(=O)O)c5ccc(=O)c(CNc6cccc7ccc(C(C)=O)nc67)c-5oc34)c2n1.O=C=O |
| InChI | InChI=1S/C44H31ClN4O8.CO2/c1-22(50)32-16-13-23-7-5-11-33(38(23)48-32)46-20-29-36(51)18-15-27-37(25-9-3-4-10-26(25)43(53)54)28-19-31(45)40(52)30(42(28)57-41(27)29)21-47-34-12-6-8-24-14-17-35(44(55)56-2)49-39(24)34;2-1-3/h3-19,46-47,52H,20-21H2,1-2H3,(H,53,54); |
| InChIKey | CPWQGUAXNKURCF-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 215.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.21 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|