C43H32N4O7 — CID 143822536
ethene;2-[3-hydroxy-6-oxo-4,5-bis[(quinolin-8-ylamino)methyl]xanthen-9-yl]terephthalic acid (PubChem CID 143822536) has the molecular formula C43H32N4O7 and a molecular weight of 716.75 g/mol. Its IUPAC name is ethene;2-[3-hydroxy-6-oxo-4,5-bis[(quinolin-8-ylamino)methyl]xanthen-9-yl]terephthalic acid.
| Compound Name | ethene;2-[3-hydroxy-6-oxo-4,5-bis[(quinolin-8-ylamino)methyl]xanthen-9-yl]terephthalic acid |
|---|---|
| PubChem CID | 143822536 |
| Molecular Formula | C43H32N4O7 |
| Molecular Weight | 716.75 g/mol |
| Exact Mass | 716.23 |
| IUPAC Name | ethene;2-[3-hydroxy-6-oxo-4,5-bis[(quinolin-8-ylamino)methyl]xanthen-9-yl]terephthalic acid |
| SMILES | C=C.O=C(O)c1ccc(C(=O)O)c(-c2c3ccc(=O)c(CNc4cccc5cccnc45)c-3oc3c(CNc4cccc5cccnc45)c(O)ccc23)c1 |
| InChI | InChI=1S/C41H28N4O7.C2H4/c46-33-15-13-26-35(28-19-24(40(48)49)11-12-25(28)41(50)51)27-14-16-34(47)30(21-45-32-10-2-6-23-8-4-18-43-37(23)32)39(27)52-38(26)29(33)20-44-31-9-1-5-22-7-3-17-42-36(22)31;1-2/h1-19,44-46H,20-21H2,(H,48,49)(H,50,51);1-2H2 |
| InChIKey | KYGRPLOWYNQAET-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 174.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.75 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|