C35H35ClN2O5S2 — CID 89130883
2-[5-[[2-[bis(2-ethylsulfanylethyl)amino]anilino]methyl]-2-chloro-6-hydroxy-3-oxoxanthen-9-yl]benzoic acid (PubChem CID 89130883) has the molecular formula C35H35ClN2O5S2 and a molecular weight of 663.26 g/mol. Its IUPAC name is 2-[5-[[2-[bis(2-ethylsulfanylethyl)amino]anilino]methyl]-2-chloro-6-hydroxy-3-oxoxanthen-9-yl]benzoic acid.
| Compound Name | 2-[5-[[2-[bis(2-ethylsulfanylethyl)amino]anilino]methyl]-2-chloro-6-hydroxy-3-oxoxanthen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 89130883 |
| Molecular Formula | C35H35ClN2O5S2 |
| Molecular Weight | 663.26 g/mol |
| Exact Mass | 662.17 |
| IUPAC Name | 2-[5-[[2-[bis(2-ethylsulfanylethyl)amino]anilino]methyl]-2-chloro-6-hydroxy-3-oxoxanthen-9-yl]benzoic acid |
| SMILES | CCSCCN(CCSCC)c1ccccc1NCc1c(O)ccc2c(-c3ccccc3C(=O)O)c3cc(Cl)c(=O)cc-3oc12 |
| InChI | InChI=1S/C35H35ClN2O5S2/c1-3-44-17-15-38(16-18-45-4-2)29-12-8-7-11-28(29)37-21-26-30(39)14-13-24-33(22-9-5-6-10-23(22)35(41)42)25-19-27(36)31(40)20-32(25)43-34(24)26/h5-14,19-20,37,39H,3-4,15-18,21H2,1-2H3,(H,41,42) |
| InChIKey | FXVYTIKYMOKBDT-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.26 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|