C28H20BNO7 — CID 143077657
2-[2-[(2-boronophenyl)methyl]-8-oxo-3H-chromeno[3,2-f][1,2]benzoxazol-5-yl]benzoic acid (PubChem CID 143077657) has the molecular formula C28H20BNO7 and a molecular weight of 493.28 g/mol. Its IUPAC name is 2-[2-[(2-boronophenyl)methyl]-8-oxo-3H-chromeno[3,2-f][1,2]benzoxazol-5-yl]benzoic acid.
| Compound Name | 2-[2-[(2-boronophenyl)methyl]-8-oxo-3H-chromeno[3,2-f][1,2]benzoxazol-5-yl]benzoic acid |
|---|---|
| PubChem CID | 143077657 |
| Molecular Formula | C28H20BNO7 |
| Molecular Weight | 493.28 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | 2-[2-[(2-boronophenyl)methyl]-8-oxo-3H-chromeno[3,2-f][1,2]benzoxazol-5-yl]benzoic acid |
| SMILES | O=C(O)c1ccccc1-c1c2ccc(=O)cc-2oc2cc3c(cc12)CN(Cc1ccccc1B(O)O)O3 |
| InChI | InChI=1S/C28H20BNO7/c31-18-9-10-21-25(12-18)36-26-13-24-17(11-22(26)27(21)19-6-2-3-7-20(19)28(32)33)15-30(37-24)14-16-5-1-4-8-23(16)29(34)35/h1-13,34-35H,14-15H2,(H,32,33) |
| InChIKey | NEMMNIZEOFBNKQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 120.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.28 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|