C25H18O5 — CID 87693451
2-[2-(3-methylbuta-1,3-dien-2-yloxy)-6-oxoxanthen-9-yl]benzoic acid (PubChem CID 87693451) has the molecular formula C25H18O5 and a molecular weight of 398.41 g/mol. Its IUPAC name is 2-[2-(3-methylbuta-1,3-dien-2-yloxy)-6-oxoxanthen-9-yl]benzoic acid.
| Compound Name | 2-[2-(3-methylbuta-1,3-dien-2-yloxy)-6-oxoxanthen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 87693451 |
| Molecular Formula | C25H18O5 |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 2-[2-(3-methylbuta-1,3-dien-2-yloxy)-6-oxoxanthen-9-yl]benzoic acid |
| SMILES | C=C(C)C(=C)Oc1ccc2oc3cc(=O)ccc-3c(-c3ccccc3C(=O)O)c2c1 |
| InChI | InChI=1S/C25H18O5/c1-14(2)15(3)29-17-9-11-22-21(13-17)24(18-6-4-5-7-19(18)25(27)28)20-10-8-16(26)12-23(20)30-22/h4-13H,1,3H2,2H3,(H,27,28) |
| InChIKey | YINIFZQIMYRMBS-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|