C15H12O5 — CID 175527129
2,7,9-trihydroxy-1,3-dimethylbenzo[c]chromen-6-one (PubChem CID 175527129) has the molecular formula C15H12O5 and a molecular weight of 272.26 g/mol. Its IUPAC name is 2,7,9-trihydroxy-1,3-dimethylbenzo[c]chromen-6-one.
| Compound Name | 2,7,9-trihydroxy-1,3-dimethylbenzo[c]chromen-6-one |
|---|---|
| PubChem CID | 175527129 |
| Molecular Formula | C15H12O5 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 2,7,9-trihydroxy-1,3-dimethylbenzo[c]chromen-6-one |
| SMILES | Cc1cc2oc(=O)c3c(O)cc(O)cc3c2c(C)c1O |
| InChI | InChI=1S/C15H12O5/c1-6-3-11-12(7(2)14(6)18)9-4-8(16)5-10(17)13(9)15(19)20-11/h3-5,16-18H,1-2H3 |
| InChIKey | FQSZIWXNMMVBDY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|