C14H10O4 — CID 11687367
3,7-dihydroxy-1-methylbenzo[c]chromen-6-one (PubChem CID 11687367) has the molecular formula C14H10O4 and a molecular weight of 242.23 g/mol. Its IUPAC name is 3,7-dihydroxy-1-methylbenzo[c]chromen-6-one.
| Compound Name | 3,7-dihydroxy-1-methylbenzo[c]chromen-6-one |
|---|---|
| PubChem CID | 11687367 |
| Molecular Formula | C14H10O4 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 3,7-dihydroxy-1-methylbenzo[c]chromen-6-one |
| SMILES | Cc1cc(O)cc2oc(=O)c3c(O)cccc3c12 |
| InChI | InChI=1S/C14H10O4/c1-7-5-8(15)6-11-12(7)9-3-2-4-10(16)13(9)14(17)18-11/h2-6,15-16H,1H3 |
| InChIKey | SQMDOLRXKSZMDC-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|