C10H7ClO5S — CID 53212392
5-chlorosulfonyl-3-methyl-1-benzofuran-2-carboxylic acid (PubChem CID 53212392) has the molecular formula C10H7ClO5S and a molecular weight of 274.68 g/mol. Its IUPAC name is 5-chlorosulfonyl-3-methyl-1-benzofuran-2-carboxylic acid.
| Compound Name | 5-chlorosulfonyl-3-methyl-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 53212392 |
| Molecular Formula | C10H7ClO5S |
| Molecular Weight | 274.68 g/mol |
| Exact Mass | 273.97 |
| IUPAC Name | 5-chlorosulfonyl-3-methyl-1-benzofuran-2-carboxylic acid |
| SMILES | Cc1c(C(=O)O)oc2ccc(S(=O)(=O)Cl)cc12 |
| InChI | InChI=1S/C10H7ClO5S/c1-5-7-4-6(17(11,14)15)2-3-8(7)16-9(5)10(12)13/h2-4H,1H3,(H,12,13) |
| InChIKey | FSWPPOSCQOPLFV-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.68 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |