C16H12N2O7S — CID 175978275
3-methyl-5-[(3-nitrophenyl)sulfamoyl]-1-benzofuran-2-carboxylic acid (PubChem CID 175978275) has the molecular formula C16H12N2O7S and a molecular weight of 376.35 g/mol. Its IUPAC name is 3-methyl-5-[(3-nitrophenyl)sulfamoyl]-1-benzofuran-2-carboxylic acid.
| Compound Name | 3-methyl-5-[(3-nitrophenyl)sulfamoyl]-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 175978275 |
| Molecular Formula | C16H12N2O7S |
| Molecular Weight | 376.35 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 3-methyl-5-[(3-nitrophenyl)sulfamoyl]-1-benzofuran-2-carboxylic acid |
| SMILES | Cc1c(C(=O)O)oc2ccc(S(=O)(=O)Nc3cccc([N+](=O)[O-])c3)cc12 |
| InChI | InChI=1S/C16H12N2O7S/c1-9-13-8-12(5-6-14(13)25-15(9)16(19)20)26(23,24)17-10-3-2-4-11(7-10)18(21)22/h2-8,17H,1H3,(H,19,20) |
| InChIKey | MARNQVWDFCNCBI-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 139.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|