C24H20N2O7S — CID 175493816
3-methyl-5-[(4-nitrophenyl)-(2-phenylethyl)sulfamoyl]-1-benzofuran-2-carboxylic acid (PubChem CID 175493816) has the molecular formula C24H20N2O7S and a molecular weight of 480.50 g/mol. Its IUPAC name is 3-methyl-5-[(4-nitrophenyl)-(2-phenylethyl)sulfamoyl]-1-benzofuran-2-carboxylic acid.
| Compound Name | 3-methyl-5-[(4-nitrophenyl)-(2-phenylethyl)sulfamoyl]-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 175493816 |
| Molecular Formula | C24H20N2O7S |
| Molecular Weight | 480.50 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | 3-methyl-5-[(4-nitrophenyl)-(2-phenylethyl)sulfamoyl]-1-benzofuran-2-carboxylic acid |
| SMILES | Cc1c(C(=O)O)oc2ccc(S(=O)(=O)N(CCc3ccccc3)c3ccc([N+](=O)[O-])cc3)cc12 |
| InChI | InChI=1S/C24H20N2O7S/c1-16-21-15-20(11-12-22(21)33-23(16)24(27)28)34(31,32)25(14-13-17-5-3-2-4-6-17)18-7-9-19(10-8-18)26(29)30/h2-12,15H,13-14H2,1H3,(H,27,28) |
| InChIKey | QRGGRABNHXWAFZ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 130.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.50 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|