C27H27N3O5S — CID 166065122
ethyl 5-[[2-(diaziridin-1-yl)phenyl]-(2-phenylethyl)sulfamoyl]-3-methyl-1-benzofuran-2-carboxylate (PubChem CID 166065122) has the molecular formula C27H27N3O5S and a molecular weight of 505.60 g/mol. Its IUPAC name is ethyl 5-[[2-(diaziridin-1-yl)phenyl]-(2-phenylethyl)sulfamoyl]-3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | ethyl 5-[[2-(diaziridin-1-yl)phenyl]-(2-phenylethyl)sulfamoyl]-3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 166065122 |
| Molecular Formula | C27H27N3O5S |
| Molecular Weight | 505.60 g/mol |
| Exact Mass | 505.17 |
| IUPAC Name | ethyl 5-[[2-(diaziridin-1-yl)phenyl]-(2-phenylethyl)sulfamoyl]-3-methyl-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)c1oc2ccc(S(=O)(=O)N(CCc3ccccc3)c3ccccc3N3CN3)cc2c1C |
| InChI | InChI=1S/C27H27N3O5S/c1-3-34-27(31)26-19(2)22-17-21(13-14-25(22)35-26)36(32,33)30(16-15-20-9-5-4-6-10-20)24-12-8-7-11-23(24)29-18-28-29/h4-14,17,28H,3,15-16,18H2,1-2H3 |
| InChIKey | GQEKXMOSFUKKCD-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 101.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.60 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|