C23H18ClNO5S — CID 127049190
5-[benzyl-(4-chlorophenyl)sulfonylamino]-3-methyl-1-benzofuran-2-carboxylic acid (PubChem CID 127049190) has the molecular formula C23H18ClNO5S and a molecular weight of 455.92 g/mol. Its IUPAC name is 5-[benzyl-(4-chlorophenyl)sulfonylamino]-3-methyl-1-benzofuran-2-carboxylic acid.
| Compound Name | 5-[benzyl-(4-chlorophenyl)sulfonylamino]-3-methyl-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 127049190 |
| Molecular Formula | C23H18ClNO5S |
| Molecular Weight | 455.92 g/mol |
| Exact Mass | 455.06 |
| IUPAC Name | 5-[benzyl-(4-chlorophenyl)sulfonylamino]-3-methyl-1-benzofuran-2-carboxylic acid |
| SMILES | Cc1c(C(=O)O)oc2ccc(N(Cc3ccccc3)S(=O)(=O)c3ccc(Cl)cc3)cc12 |
| InChI | InChI=1S/C23H18ClNO5S/c1-15-20-13-18(9-12-21(20)30-22(15)23(26)27)25(14-16-5-3-2-4-6-16)31(28,29)19-10-7-17(24)8-11-19/h2-13H,14H2,1H3,(H,26,27) |
| InChIKey | DCNDHRVXMWVOQN-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.92 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |