C32H35N3O7S — CID 167174433
3-methyl-5-[2-phenylethyl-[4-(4-propoxycarbonylpiperazin-1-yl)phenyl]sulfamoyl]-1-benzofuran-2-carboxylic acid (PubChem CID 167174433) has the molecular formula C32H35N3O7S and a molecular weight of 605.71 g/mol. Its IUPAC name is 3-methyl-5-[2-phenylethyl-[4-(4-propoxycarbonylpiperazin-1-yl)phenyl]sulfamoyl]-1-benzofuran-2-carboxylic acid.
| Compound Name | 3-methyl-5-[2-phenylethyl-[4-(4-propoxycarbonylpiperazin-1-yl)phenyl]sulfamoyl]-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 167174433 |
| Molecular Formula | C32H35N3O7S |
| Molecular Weight | 605.71 g/mol |
| Exact Mass | 605.22 |
| IUPAC Name | 3-methyl-5-[2-phenylethyl-[4-(4-propoxycarbonylpiperazin-1-yl)phenyl]sulfamoyl]-1-benzofuran-2-carboxylic acid |
| SMILES | CCCOC(=O)N1CCN(c2ccc(N(CCc3ccccc3)S(=O)(=O)c3ccc4oc(C(=O)O)c(C)c4c3)cc2)CC1 |
| InChI | InChI=1S/C32H35N3O7S/c1-3-21-41-32(38)34-19-17-33(18-20-34)25-9-11-26(12-10-25)35(16-15-24-7-5-4-6-8-24)43(39,40)27-13-14-29-28(22-27)23(2)30(42-29)31(36)37/h4-14,22H,3,15-21H2,1-2H3,(H,36,37) |
| InChIKey | KHIVMEVAVGQFAP-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 120.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.71 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|