C18H17NO6S — CID 170307561
5-[1-(3-hydroxyphenyl)ethylsulfamoyl]-3-methyl-1-benzofuran-2-carboxylic acid (PubChem CID 170307561) has the molecular formula C18H17NO6S and a molecular weight of 375.40 g/mol. Its IUPAC name is 5-[1-(3-hydroxyphenyl)ethylsulfamoyl]-3-methyl-1-benzofuran-2-carboxylic acid.
| Compound Name | 5-[1-(3-hydroxyphenyl)ethylsulfamoyl]-3-methyl-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 170307561 |
| Molecular Formula | C18H17NO6S |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | 5-[1-(3-hydroxyphenyl)ethylsulfamoyl]-3-methyl-1-benzofuran-2-carboxylic acid |
| SMILES | Cc1c(C(=O)O)oc2ccc(S(=O)(=O)NC(C)c3cccc(O)c3)cc12 |
| InChI | InChI=1S/C18H17NO6S/c1-10-15-9-14(6-7-16(15)25-17(10)18(21)22)26(23,24)19-11(2)12-4-3-5-13(20)8-12/h3-9,11,19-20H,1-2H3,(H,21,22) |
| InChIKey | ORKBINXKNMTTHP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |