C20H19NO6S — CID 170307603
5-[1-(3-acetylphenyl)ethylsulfamoyl]-3-methyl-1-benzofuran-2-carboxylic acid (PubChem CID 170307603) has the molecular formula C20H19NO6S and a molecular weight of 401.44 g/mol. Its IUPAC name is 5-[1-(3-acetylphenyl)ethylsulfamoyl]-3-methyl-1-benzofuran-2-carboxylic acid.
| Compound Name | 5-[1-(3-acetylphenyl)ethylsulfamoyl]-3-methyl-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 170307603 |
| Molecular Formula | C20H19NO6S |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | 5-[1-(3-acetylphenyl)ethylsulfamoyl]-3-methyl-1-benzofuran-2-carboxylic acid |
| SMILES | CC(=O)c1cccc(C(C)NS(=O)(=O)c2ccc3oc(C(=O)O)c(C)c3c2)c1 |
| InChI | InChI=1S/C20H19NO6S/c1-11-17-10-16(7-8-18(17)27-19(11)20(23)24)28(25,26)21-12(2)14-5-4-6-15(9-14)13(3)22/h4-10,12,21H,1-3H3,(H,23,24) |
| InChIKey | HUYDPSKGSGECEL-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |