C15H14N2O6S — CID 886334
3,4-dimethyl-5-[(3-nitrophenyl)sulfamoyl]benzoic acid (PubChem CID 886334) has the molecular formula C15H14N2O6S and a molecular weight of 350.35 g/mol. Its IUPAC name is 3,4-dimethyl-5-[(3-nitrophenyl)sulfamoyl]benzoic acid.
| Compound Name | 3,4-dimethyl-5-[(3-nitrophenyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 886334 |
| Molecular Formula | C15H14N2O6S |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | 3,4-dimethyl-5-[(3-nitrophenyl)sulfamoyl]benzoic acid |
| SMILES | Cc1cc(C(=O)O)cc(S(=O)(=O)Nc2cccc([N+](=O)[O-])c2)c1C |
| InChI | InChI=1S/C15H14N2O6S/c1-9-6-11(15(18)19)7-14(10(9)2)24(22,23)16-12-4-3-5-13(8-12)17(20)21/h3-8,16H,1-2H3,(H,18,19) |
| InChIKey | YCXSKXINYZRFOL-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 126.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|