C19H20N2O5S — CID 22109123
3-[[3-(cyclopropylcarbamoyl)phenyl]sulfamoyl]-4,5-dimethylbenzoic acid (PubChem CID 22109123) has the molecular formula C19H20N2O5S and a molecular weight of 388.45 g/mol. Its IUPAC name is 3-[[3-(cyclopropylcarbamoyl)phenyl]sulfamoyl]-4,5-dimethylbenzoic acid.
| Compound Name | 3-[[3-(cyclopropylcarbamoyl)phenyl]sulfamoyl]-4,5-dimethylbenzoic acid |
|---|---|
| PubChem CID | 22109123 |
| Molecular Formula | C19H20N2O5S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 3-[[3-(cyclopropylcarbamoyl)phenyl]sulfamoyl]-4,5-dimethylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)cc(S(=O)(=O)Nc2cccc(C(=O)NC3CC3)c2)c1C |
| InChI | InChI=1S/C19H20N2O5S/c1-11-8-14(19(23)24)10-17(12(11)2)27(25,26)21-16-5-3-4-13(9-16)18(22)20-15-6-7-15/h3-5,8-10,15,21H,6-7H2,1-2H3,(H,20,22)(H,23,24) |
| InChIKey | FGDYNNUNQZTWSA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |