C20H17ClN2O6S2 — CID 2213482
3-(4-chlorophenyl)sulfonyl-2,5-dimethyl-N-(3-nitrophenyl)benzenesulfonamide (PubChem CID 2213482) has the molecular formula C20H17ClN2O6S2 and a molecular weight of 480.95 g/mol. Its IUPAC name is 3-(4-chlorophenyl)sulfonyl-2,5-dimethyl-N-(3-nitrophenyl)benzenesulfonamide.
| Compound Name | 3-(4-chlorophenyl)sulfonyl-2,5-dimethyl-N-(3-nitrophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 2213482 |
| Molecular Formula | C20H17ClN2O6S2 |
| Molecular Weight | 480.95 g/mol |
| Exact Mass | 480.02 |
| IUPAC Name | 3-(4-chlorophenyl)sulfonyl-2,5-dimethyl-N-(3-nitrophenyl)benzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)Nc2cccc([N+](=O)[O-])c2)c(C)c(S(=O)(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C20H17ClN2O6S2/c1-13-10-19(30(26,27)18-8-6-15(21)7-9-18)14(2)20(11-13)31(28,29)22-16-4-3-5-17(12-16)23(24)25/h3-12,22H,1-2H3 |
| InChIKey | QODBZRLZYHSDIU-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 123.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.95 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|