C17H20N2O6S2 — CID 7516597
3-[[4-(dimethylsulfamoyl)phenyl]sulfamoyl]-4,5-dimethylbenzoic acid (PubChem CID 7516597) has the molecular formula C17H20N2O6S2 and a molecular weight of 412.49 g/mol. Its IUPAC name is 3-[[4-(dimethylsulfamoyl)phenyl]sulfamoyl]-4,5-dimethylbenzoic acid.
| Compound Name | 3-[[4-(dimethylsulfamoyl)phenyl]sulfamoyl]-4,5-dimethylbenzoic acid |
|---|---|
| PubChem CID | 7516597 |
| Molecular Formula | C17H20N2O6S2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | 3-[[4-(dimethylsulfamoyl)phenyl]sulfamoyl]-4,5-dimethylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)cc(S(=O)(=O)Nc2ccc(S(=O)(=O)N(C)C)cc2)c1C |
| InChI | InChI=1S/C17H20N2O6S2/c1-11-9-13(17(20)21)10-16(12(11)2)26(22,23)18-14-5-7-15(8-6-14)27(24,25)19(3)4/h5-10,18H,1-4H3,(H,20,21) |
| InChIKey | GMIXLDZEMOLPFT-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |