C17H21NO5S — CID 4064905
5-(2-ethylpiperidin-1-yl)sulfonyl-3-methyl-1-benzofuran-2-carboxylic acid (PubChem CID 4064905) has the molecular formula C17H21NO5S and a molecular weight of 351.42 g/mol. Its IUPAC name is 5-(2-ethylpiperidin-1-yl)sulfonyl-3-methyl-1-benzofuran-2-carboxylic acid.
| Compound Name | 5-(2-ethylpiperidin-1-yl)sulfonyl-3-methyl-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 4064905 |
| Molecular Formula | C17H21NO5S |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 5-(2-ethylpiperidin-1-yl)sulfonyl-3-methyl-1-benzofuran-2-carboxylic acid |
| SMILES | CCC1CCCCN1S(=O)(=O)c1ccc2oc(C(=O)O)c(C)c2c1 |
| InChI | InChI=1S/C17H21NO5S/c1-3-12-6-4-5-9-18(12)24(21,22)13-7-8-15-14(10-13)11(2)16(23-15)17(19)20/h7-8,10,12H,3-6,9H2,1-2H3,(H,19,20) |
| InChIKey | RIPMIWGMURZZCE-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |