C24H26FNO5S — CID 92502954
ethyl 5-[(2R)-2-(3-fluorophenyl)azepan-1-yl]sulfonyl-3-methyl-1-benzofuran-2-carboxylate (PubChem CID 92502954) has the molecular formula C24H26FNO5S and a molecular weight of 459.54 g/mol. Its IUPAC name is ethyl 5-[(2R)-2-(3-fluorophenyl)azepan-1-yl]sulfonyl-3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | ethyl 5-[(2R)-2-(3-fluorophenyl)azepan-1-yl]sulfonyl-3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 92502954 |
| Molecular Formula | C24H26FNO5S |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | ethyl 5-[(2R)-2-(3-fluorophenyl)azepan-1-yl]sulfonyl-3-methyl-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)c1oc2ccc(S(=O)(=O)N3CCCCC[C@@H]3c3cccc(F)c3)cc2c1C |
| InChI | InChI=1S/C24H26FNO5S/c1-3-30-24(27)23-16(2)20-15-19(11-12-22(20)31-23)32(28,29)26-13-6-4-5-10-21(26)17-8-7-9-18(25)14-17/h7-9,11-12,14-15,21H,3-6,10,13H2,1-2H3/t21-/m1/s1 |
| InChIKey | LHUXLBFIJVTVQD-OAQYLSRUSA-N |
| XLogP | 5.36 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |