C11H11NaO5S — CID 173352072
sodium;2,3-dimethyl-4-oxochromene-6-sulfonic acid;hydride (PubChem CID 173352072) has the molecular formula C11H11NaO5S and a molecular weight of 278.26 g/mol. Its IUPAC name is sodium;2,3-dimethyl-4-oxochromene-6-sulfonic acid;hydride.
| Compound Name | sodium;2,3-dimethyl-4-oxochromene-6-sulfonic acid;hydride |
|---|---|
| PubChem CID | 173352072 |
| Molecular Formula | C11H11NaO5S |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | sodium;2,3-dimethyl-4-oxochromene-6-sulfonic acid;hydride |
| SMILES | Cc1oc2ccc(S(=O)(=O)O)cc2c(=O)c1C.[H-].[Na+] |
| InChI | InChI=1S/C11H10O5S.Na.H/c1-6-7(2)16-10-4-3-8(17(13,14)15)5-9(10)11(6)12;;/h3-5H,1-2H3,(H,13,14,15);;/q;+1;-1 |
| InChIKey | LASCDQZMOGTJAP-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|