C13H14NO6+ — CID 102072650
[(1S)-1-carboxy-2-(5-hydroxy-7-methoxy-2-oxochromen-4-yl)ethyl]azanium (PubChem CID 102072650) has the molecular formula C13H14NO6+ and a molecular weight of 280.26 g/mol. Its IUPAC name is [(1S)-1-carboxy-2-(5-hydroxy-7-methoxy-2-oxochromen-4-yl)ethyl]azanium.
| Compound Name | [(1S)-1-carboxy-2-(5-hydroxy-7-methoxy-2-oxochromen-4-yl)ethyl]azanium |
|---|---|
| PubChem CID | 102072650 |
| Molecular Formula | C13H14NO6+ |
| Molecular Weight | 280.26 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | [(1S)-1-carboxy-2-(5-hydroxy-7-methoxy-2-oxochromen-4-yl)ethyl]azanium |
| SMILES | COc1cc(O)c2c(C[C@H]([NH3+])C(=O)O)cc(=O)oc2c1 |
| InChI | InChI=1S/C13H13NO6/c1-19-7-4-9(15)12-6(2-8(14)13(17)18)3-11(16)20-10(12)5-7/h3-5,8,15H,2,14H2,1H3,(H,17,18)/p+1/t8-/m0/s1 |
| InChIKey | ABRGAJHXKTWNIL-QMMMGPOBSA-O |
| XLogP | -0.26 |
| TPSA | 124.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.26 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|