C15H14F3NO8 — CID 11349891
(2S)-2-amino-3-(7-hydroxy-5-methoxy-2-oxochromen-4-yl)propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 11349891) has the molecular formula C15H14F3NO8 and a molecular weight of 393.27 g/mol. Its IUPAC name is (2S)-2-amino-3-(7-hydroxy-5-methoxy-2-oxochromen-4-yl)propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (2S)-2-amino-3-(7-hydroxy-5-methoxy-2-oxochromen-4-yl)propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 11349891 |
| Molecular Formula | C15H14F3NO8 |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | (2S)-2-amino-3-(7-hydroxy-5-methoxy-2-oxochromen-4-yl)propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | COc1cc(O)cc2oc(=O)cc(C[C@H](N)C(=O)O)c12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H13NO6.C2HF3O2/c1-19-9-4-7(15)5-10-12(9)6(3-11(16)20-10)2-8(14)13(17)18;3-2(4,5)1(6)7/h3-5,8,15H,2,14H2,1H3,(H,17,18);(H,6,7)/t8-;/m0./s1 |
| InChIKey | VZLPTOVEOCJDLG-QRPNPIFTSA-N |
| XLogP | 1.09 |
| TPSA | 160.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|