C18H24O6 — CID 142122957
(5,7-dimethoxy-2-oxochromen-4-yl)methyl 2-methylpropanoate;ethane (PubChem CID 142122957) has the molecular formula C18H24O6 and a molecular weight of 336.38 g/mol. Its IUPAC name is (5,7-dimethoxy-2-oxochromen-4-yl)methyl 2-methylpropanoate;ethane.
| Compound Name | (5,7-dimethoxy-2-oxochromen-4-yl)methyl 2-methylpropanoate;ethane |
|---|---|
| PubChem CID | 142122957 |
| Molecular Formula | C18H24O6 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | (5,7-dimethoxy-2-oxochromen-4-yl)methyl 2-methylpropanoate;ethane |
| SMILES | CC.COc1cc(OC)c2c(COC(=O)C(C)C)cc(=O)oc2c1 |
| InChI | InChI=1S/C16H18O6.C2H6/c1-9(2)16(18)21-8-10-5-14(17)22-13-7-11(19-3)6-12(20-4)15(10)13;1-2/h5-7,9H,8H2,1-4H3;1-2H3 |
| InChIKey | LWJQGQGQTFDBTO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|