C28H27NO7 — CID 51898667
(3-oxobenzo[f]chromen-1-yl)methyl (2S)-2-[(3,5-dimethoxybenzoyl)amino]-3-methylbutanoate (PubChem CID 51898667) has the molecular formula C28H27NO7 and a molecular weight of 489.52 g/mol. Its IUPAC name is (3-oxobenzo[f]chromen-1-yl)methyl (2S)-2-[(3,5-dimethoxybenzoyl)amino]-3-methylbutanoate.
| Compound Name | (3-oxobenzo[f]chromen-1-yl)methyl (2S)-2-[(3,5-dimethoxybenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 51898667 |
| Molecular Formula | C28H27NO7 |
| Molecular Weight | 489.52 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | (3-oxobenzo[f]chromen-1-yl)methyl (2S)-2-[(3,5-dimethoxybenzoyl)amino]-3-methylbutanoate |
| SMILES | COc1cc(OC)cc(C(=O)N[C@H](C(=O)OCc2cc(=O)oc3ccc4ccccc4c23)C(C)C)c1 |
| InChI | InChI=1S/C28H27NO7/c1-16(2)26(29-27(31)18-11-20(33-3)14-21(12-18)34-4)28(32)35-15-19-13-24(30)36-23-10-9-17-7-5-6-8-22(17)25(19)23/h5-14,16,26H,15H2,1-4H3,(H,29,31)/t26-/m0/s1 |
| InChIKey | YSPDNGWOYNNNIN-SANMLTNESA-N |
| XLogP | 4.46 |
| TPSA | 104.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.52 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|