C10H8O5 — CID 82371903
4,5-dihydroxy-7-methoxychromen-2-one (PubChem CID 82371903) has the molecular formula C10H8O5 and a molecular weight of 208.17 g/mol. Its IUPAC name is 4,5-dihydroxy-7-methoxychromen-2-one.
| Compound Name | 4,5-dihydroxy-7-methoxychromen-2-one |
|---|---|
| PubChem CID | 82371903 |
| Molecular Formula | C10H8O5 |
| Molecular Weight | 208.17 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | 4,5-dihydroxy-7-methoxychromen-2-one |
| SMILES | COc1cc(O)c2c(O)cc(=O)oc2c1 |
| InChI | InChI=1S/C10H8O5/c1-14-5-2-6(11)10-7(12)4-9(13)15-8(10)3-5/h2-4,11-12H,1H3 |
| InChIKey | IGSAEJJHDXBOLT-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.17 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|