C14H14O6 — CID 10934753
4-(1,3-dioxolan-2-yl)-5,7-dimethoxychromen-2-one (PubChem CID 10934753) has the molecular formula C14H14O6 and a molecular weight of 278.26 g/mol. Its IUPAC name is 4-(1,3-dioxolan-2-yl)-5,7-dimethoxychromen-2-one.
| Compound Name | 4-(1,3-dioxolan-2-yl)-5,7-dimethoxychromen-2-one |
|---|---|
| PubChem CID | 10934753 |
| Molecular Formula | C14H14O6 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 4-(1,3-dioxolan-2-yl)-5,7-dimethoxychromen-2-one |
| SMILES | COc1cc(OC)c2c(C3OCCO3)cc(=O)oc2c1 |
| InChI | InChI=1S/C14H14O6/c1-16-8-5-10(17-2)13-9(14-18-3-4-19-14)7-12(15)20-11(13)6-8/h5-7,14H,3-4H2,1-2H3 |
| InChIKey | FTOBMPWQKZRFOD-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 67.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|