C13H16O6 — CID 170874053
methyl 2-(1,3-dioxolan-2-yl)-3,5-dimethoxybenzoate (PubChem CID 170874053) has the molecular formula C13H16O6 and a molecular weight of 268.26 g/mol. Its IUPAC name is methyl 2-(1,3-dioxolan-2-yl)-3,5-dimethoxybenzoate.
| Compound Name | methyl 2-(1,3-dioxolan-2-yl)-3,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 170874053 |
| Molecular Formula | C13H16O6 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | methyl 2-(1,3-dioxolan-2-yl)-3,5-dimethoxybenzoate |
| SMILES | COC(=O)c1cc(OC)cc(OC)c1C1OCCO1 |
| InChI | InChI=1S/C13H16O6/c1-15-8-6-9(12(14)17-3)11(10(7-8)16-2)13-18-4-5-19-13/h6-7,13H,4-5H2,1-3H3 |
| InChIKey | IALXZEXHPDNNBG-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |