C13H16O5 — CID 6710788
methyl 3,5-dimethoxy-2-propanoylbenzoate (PubChem CID 6710788) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is methyl 3,5-dimethoxy-2-propanoylbenzoate.
| Compound Name | methyl 3,5-dimethoxy-2-propanoylbenzoate |
|---|---|
| PubChem CID | 6710788 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | methyl 3,5-dimethoxy-2-propanoylbenzoate |
| SMILES | CCC(=O)c1c(OC)cc(OC)cc1C(=O)OC |
| InChI | InChI=1S/C13H16O5/c1-5-10(14)12-9(13(15)18-4)6-8(16-2)7-11(12)17-3/h6-7H,5H2,1-4H3 |
| InChIKey | MOWOKJBINDKNSJ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |