C19H20O10S — CID 156581974
methyl 2-(2,6-dimethoxy-4-methylbenzoyl)-3-methoxy-5-sulfooxybenzoate (PubChem CID 156581974) has the molecular formula C19H20O10S and a molecular weight of 440.43 g/mol. Its IUPAC name is methyl 2-(2,6-dimethoxy-4-methylbenzoyl)-3-methoxy-5-sulfooxybenzoate.
| Compound Name | methyl 2-(2,6-dimethoxy-4-methylbenzoyl)-3-methoxy-5-sulfooxybenzoate |
|---|---|
| PubChem CID | 156581974 |
| Molecular Formula | C19H20O10S |
| Molecular Weight | 440.43 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | methyl 2-(2,6-dimethoxy-4-methylbenzoyl)-3-methoxy-5-sulfooxybenzoate |
| SMILES | COC(=O)c1cc(OS(=O)(=O)O)cc(OC)c1C(=O)c1c(OC)cc(C)cc1OC |
| InChI | InChI=1S/C19H20O10S/c1-10-6-13(25-2)17(14(7-10)26-3)18(20)16-12(19(21)28-5)8-11(9-15(16)27-4)29-30(22,23)24/h6-9H,1-5H3,(H,22,23,24) |
| InChIKey | DAOCGGYTJPNNGC-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.43 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|