C19H17NO6 — CID 10760652
methyl 2-(2-cyano-6-methoxybenzoyl)-3,5-dimethoxybenzoate (PubChem CID 10760652) has the molecular formula C19H17NO6 and a molecular weight of 355.35 g/mol. Its IUPAC name is methyl 2-(2-cyano-6-methoxybenzoyl)-3,5-dimethoxybenzoate.
| Compound Name | methyl 2-(2-cyano-6-methoxybenzoyl)-3,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 10760652 |
| Molecular Formula | C19H17NO6 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | methyl 2-(2-cyano-6-methoxybenzoyl)-3,5-dimethoxybenzoate |
| SMILES | COC(=O)c1cc(OC)cc(OC)c1C(=O)c1c(C#N)cccc1OC |
| InChI | InChI=1S/C19H17NO6/c1-23-12-8-13(19(22)26-4)17(15(9-12)25-3)18(21)16-11(10-20)6-5-7-14(16)24-2/h5-9H,1-4H3 |
| InChIKey | LGUQUHMCYQQKNR-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 94.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |