C11H11BrO5 — CID 142693317
methyl 3-bromo-5-(1,3-dioxolan-2-yl)-2-hydroxybenzoate (PubChem CID 142693317) has the molecular formula C11H11BrO5 and a molecular weight of 303.11 g/mol. Its IUPAC name is methyl 3-bromo-5-(1,3-dioxolan-2-yl)-2-hydroxybenzoate.
| Compound Name | methyl 3-bromo-5-(1,3-dioxolan-2-yl)-2-hydroxybenzoate |
|---|---|
| PubChem CID | 142693317 |
| Molecular Formula | C11H11BrO5 |
| Molecular Weight | 303.11 g/mol |
| Exact Mass | 301.98 |
| IUPAC Name | methyl 3-bromo-5-(1,3-dioxolan-2-yl)-2-hydroxybenzoate |
| SMILES | COC(=O)c1cc(C2OCCO2)cc(Br)c1O |
| InChI | InChI=1S/C11H11BrO5/c1-15-10(14)7-4-6(5-8(12)9(7)13)11-16-2-3-17-11/h4-5,11,13H,2-3H2,1H3 |
| InChIKey | WEKWGMPJJHGDHQ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.11 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |