C14H16F2O4 — CID 135125901
methyl 5-(5,5-dimethyl-1,3-dioxan-2-yl)-2,3-difluorobenzoate (PubChem CID 135125901) has the molecular formula C14H16F2O4 and a molecular weight of 286.27 g/mol. Its IUPAC name is methyl 5-(5,5-dimethyl-1,3-dioxan-2-yl)-2,3-difluorobenzoate.
| Compound Name | methyl 5-(5,5-dimethyl-1,3-dioxan-2-yl)-2,3-difluorobenzoate |
|---|---|
| PubChem CID | 135125901 |
| Molecular Formula | C14H16F2O4 |
| Molecular Weight | 286.27 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | methyl 5-(5,5-dimethyl-1,3-dioxan-2-yl)-2,3-difluorobenzoate |
| SMILES | COC(=O)c1cc(C2OCC(C)(C)CO2)cc(F)c1F |
| InChI | InChI=1S/C14H16F2O4/c1-14(2)6-19-13(20-7-14)8-4-9(12(17)18-3)11(16)10(15)5-8/h4-5,13H,6-7H2,1-3H3 |
| InChIKey | WFGFKZSAWQEEJB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.27 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |