C9H6F2O4 — CID 19754855
methyl 6,7-difluoro-1,3-benzodioxole-5-carboxylate (PubChem CID 19754855) has the molecular formula C9H6F2O4 and a molecular weight of 216.14 g/mol. Its IUPAC name is methyl 6,7-difluoro-1,3-benzodioxole-5-carboxylate.
| Compound Name | methyl 6,7-difluoro-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 19754855 |
| Molecular Formula | C9H6F2O4 |
| Molecular Weight | 216.14 g/mol |
| Exact Mass | 216.02 |
| IUPAC Name | methyl 6,7-difluoro-1,3-benzodioxole-5-carboxylate |
| SMILES | COC(=O)c1cc2c(c(F)c1F)OCO2 |
| InChI | InChI=1S/C9H6F2O4/c1-13-9(12)4-2-5-8(15-3-14-5)7(11)6(4)10/h2H,3H2,1H3 |
| InChIKey | UAIQSFLCGHVKHY-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.14 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |