C23H26N2O5 — CID 7201466
methyl 2-[(4R)-3-cyano-2,7,7-trimethyl-5-oxo-3,4,6,8-tetrahydroquinolin-4-yl]-3,5-dimethoxybenzoate (PubChem CID 7201466) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is methyl 2-[(4R)-3-cyano-2,7,7-trimethyl-5-oxo-3,4,6,8-tetrahydroquinolin-4-yl]-3,5-dimethoxybenzoate.
| Compound Name | methyl 2-[(4R)-3-cyano-2,7,7-trimethyl-5-oxo-3,4,6,8-tetrahydroquinolin-4-yl]-3,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 7201466 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | methyl 2-[(4R)-3-cyano-2,7,7-trimethyl-5-oxo-3,4,6,8-tetrahydroquinolin-4-yl]-3,5-dimethoxybenzoate |
| SMILES | COC(=O)c1cc(OC)cc(OC)c1[C@@H]1C2=C(CC(C)(C)CC2=O)N=C(C)C1C#N |
| InChI | InChI=1S/C23H26N2O5/c1-12-15(11-24)20(21-16(25-12)9-23(2,3)10-17(21)26)19-14(22(27)30-6)7-13(28-4)8-18(19)29-5/h7-8,15,20H,9-10H2,1-6H3/t15?,20-/m1/s1 |
| InChIKey | AAAIIHYWEPXXHG-YQYDADCPSA-N |
| XLogP | 3.83 |
| TPSA | 97.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |