C19H18Cl2N2O — CID 7066001
(4R)-4-(2,4-dichlorophenyl)-2,7,7-trimethyl-5-oxo-3,4,6,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 7066001) has the molecular formula C19H18Cl2N2O and a molecular weight of 361.27 g/mol. Its IUPAC name is (4R)-4-(2,4-dichlorophenyl)-2,7,7-trimethyl-5-oxo-3,4,6,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | (4R)-4-(2,4-dichlorophenyl)-2,7,7-trimethyl-5-oxo-3,4,6,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 7066001 |
| Molecular Formula | C19H18Cl2N2O |
| Molecular Weight | 361.27 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | (4R)-4-(2,4-dichlorophenyl)-2,7,7-trimethyl-5-oxo-3,4,6,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | CC1=NC2=C(C(=O)CC(C)(C)C2)[C@H](c2ccc(Cl)cc2Cl)C1C#N |
| InChI | InChI=1S/C19H18Cl2N2O/c1-10-13(9-22)17(12-5-4-11(20)6-14(12)21)18-15(23-10)7-19(2,3)8-16(18)24/h4-6,13,17H,7-8H2,1-3H3/t13?,17-/m1/s1 |
| InChIKey | DHXOMTWVJFARHF-LRHAYUFXSA-N |
| XLogP | 5.33 |
| TPSA | 53.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.27 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |