C24H19Cl2NO2 — CID 31113969
(10R,10aS)-10-(2,4-dichlorophenyl)-7,7-dimethyl-6,8,10,10a-tetrahydroindeno[1,2-b]quinoline-9,11-dione (PubChem CID 31113969) has the molecular formula C24H19Cl2NO2 and a molecular weight of 424.33 g/mol. Its IUPAC name is (10R,10aS)-10-(2,4-dichlorophenyl)-7,7-dimethyl-6,8,10,10a-tetrahydroindeno[1,2-b]quinoline-9,11-dione.
| Compound Name | (10R,10aS)-10-(2,4-dichlorophenyl)-7,7-dimethyl-6,8,10,10a-tetrahydroindeno[1,2-b]quinoline-9,11-dione |
|---|---|
| PubChem CID | 31113969 |
| Molecular Formula | C24H19Cl2NO2 |
| Molecular Weight | 424.33 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | (10R,10aS)-10-(2,4-dichlorophenyl)-7,7-dimethyl-6,8,10,10a-tetrahydroindeno[1,2-b]quinoline-9,11-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)N=C1c3ccccc3C(=O)[C@H]1[C@H]2c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H19Cl2NO2/c1-24(2)10-17-20(18(28)11-24)19(15-8-7-12(25)9-16(15)26)21-22(27-17)13-5-3-4-6-14(13)23(21)29/h3-9,19,21H,10-11H2,1-2H3/t19-,21-/m0/s1 |
| InChIKey | FLNHXIZNFPNIRI-FPOVZHCZSA-N |
| XLogP | 6.04 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.33 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_phenone_B(1)', 'substructure': 'N/A'} |
|---|