C24H27Cl2NO3 — CID 7086396
cyclopentyl (4R)-4-(2,4-dichlorophenyl)-2,7,7-trimethyl-5-oxo-3,4,6,8-tetrahydroquinoline-3-carboxylate (PubChem CID 7086396) has the molecular formula C24H27Cl2NO3 and a molecular weight of 448.39 g/mol. Its IUPAC name is cyclopentyl (4R)-4-(2,4-dichlorophenyl)-2,7,7-trimethyl-5-oxo-3,4,6,8-tetrahydroquinoline-3-carboxylate.
| Compound Name | cyclopentyl (4R)-4-(2,4-dichlorophenyl)-2,7,7-trimethyl-5-oxo-3,4,6,8-tetrahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 7086396 |
| Molecular Formula | C24H27Cl2NO3 |
| Molecular Weight | 448.39 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | cyclopentyl (4R)-4-(2,4-dichlorophenyl)-2,7,7-trimethyl-5-oxo-3,4,6,8-tetrahydroquinoline-3-carboxylate |
| SMILES | CC1=NC2=C(C(=O)CC(C)(C)C2)[C@H](c2ccc(Cl)cc2Cl)C1C(=O)OC1CCCC1 |
| InChI | InChI=1S/C24H27Cl2NO3/c1-13-20(23(29)30-15-6-4-5-7-15)21(16-9-8-14(25)10-17(16)26)22-18(27-13)11-24(2,3)12-19(22)28/h8-10,15,20-21H,4-7,11-12H2,1-3H3/t20?,21-/m1/s1 |
| InChIKey | IAHBJAXZDWRUCK-BPGUCPLFSA-N |
| XLogP | 6.30 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.39 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |