C26H33NO4 — CID 6961432
cyclohexyl (4R)-4-(2-methoxyphenyl)-2,7,7-trimethyl-5-oxo-3,4,6,8-tetrahydroquinoline-3-carboxylate (PubChem CID 6961432) has the molecular formula C26H33NO4 and a molecular weight of 423.55 g/mol. Its IUPAC name is cyclohexyl (4R)-4-(2-methoxyphenyl)-2,7,7-trimethyl-5-oxo-3,4,6,8-tetrahydroquinoline-3-carboxylate.
| Compound Name | cyclohexyl (4R)-4-(2-methoxyphenyl)-2,7,7-trimethyl-5-oxo-3,4,6,8-tetrahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 6961432 |
| Molecular Formula | C26H33NO4 |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | cyclohexyl (4R)-4-(2-methoxyphenyl)-2,7,7-trimethyl-5-oxo-3,4,6,8-tetrahydroquinoline-3-carboxylate |
| SMILES | COc1ccccc1[C@@H]1C2=C(CC(C)(C)CC2=O)N=C(C)C1C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C26H33NO4/c1-16-22(25(29)31-17-10-6-5-7-11-17)23(18-12-8-9-13-21(18)30-4)24-19(27-16)14-26(2,3)15-20(24)28/h8-9,12-13,17,22-23H,5-7,10-11,14-15H2,1-4H3/t22?,23-/m0/s1 |
| InChIKey | USMFPMCJIDTTFL-WCSIJFPASA-N |
| XLogP | 5.39 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |