C28H37NO4 — CID 7086457
cyclohexyl (4S)-2,7,7-trimethyl-5-oxo-4-(2-propan-2-yloxyphenyl)-3,4,6,8-tetrahydroquinoline-3-carboxylate (PubChem CID 7086457) has the molecular formula C28H37NO4 and a molecular weight of 451.61 g/mol. Its IUPAC name is cyclohexyl (4S)-2,7,7-trimethyl-5-oxo-4-(2-propan-2-yloxyphenyl)-3,4,6,8-tetrahydroquinoline-3-carboxylate.
| Compound Name | cyclohexyl (4S)-2,7,7-trimethyl-5-oxo-4-(2-propan-2-yloxyphenyl)-3,4,6,8-tetrahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 7086457 |
| Molecular Formula | C28H37NO4 |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.27 |
| IUPAC Name | cyclohexyl (4S)-2,7,7-trimethyl-5-oxo-4-(2-propan-2-yloxyphenyl)-3,4,6,8-tetrahydroquinoline-3-carboxylate |
| SMILES | CC1=NC2=C(C(=O)CC(C)(C)C2)[C@H](c2ccccc2OC(C)C)C1C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C28H37NO4/c1-17(2)32-23-14-10-9-13-20(23)25-24(27(31)33-19-11-7-6-8-12-19)18(3)29-21-15-28(4,5)16-22(30)26(21)25/h9-10,13-14,17,19,24-25H,6-8,11-12,15-16H2,1-5H3/t24?,25-/m1/s1 |
| InChIKey | NECINTPXWGCDCF-WUBHUQEYSA-N |
| XLogP | 6.17 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |