C25H30ClNO5 — CID 6967975
cyclopentyl (4S)-4-(3-chloro-4-hydroxy-5-methoxyphenyl)-2,7,7-trimethyl-5-oxo-3,4,6,8-tetrahydroquinoline-3-carboxylate (PubChem CID 6967975) has the molecular formula C25H30ClNO5 and a molecular weight of 459.97 g/mol. Its IUPAC name is cyclopentyl (4S)-4-(3-chloro-4-hydroxy-5-methoxyphenyl)-2,7,7-trimethyl-5-oxo-3,4,6,8-tetrahydroquinoline-3-carboxylate.
| Compound Name | cyclopentyl (4S)-4-(3-chloro-4-hydroxy-5-methoxyphenyl)-2,7,7-trimethyl-5-oxo-3,4,6,8-tetrahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 6967975 |
| Molecular Formula | C25H30ClNO5 |
| Molecular Weight | 459.97 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | cyclopentyl (4S)-4-(3-chloro-4-hydroxy-5-methoxyphenyl)-2,7,7-trimethyl-5-oxo-3,4,6,8-tetrahydroquinoline-3-carboxylate |
| SMILES | COc1cc([C@H]2C3=C(CC(C)(C)CC3=O)N=C(C)C2C(=O)OC2CCCC2)cc(Cl)c1O |
| InChI | InChI=1S/C25H30ClNO5/c1-13-20(24(30)32-15-7-5-6-8-15)21(14-9-16(26)23(29)19(10-14)31-4)22-17(27-13)11-25(2,3)12-18(22)28/h9-10,15,20-21,29H,5-8,11-12H2,1-4H3/t20?,21-/m1/s1 |
| InChIKey | YQBMXKAMBKQLAX-BPGUCPLFSA-N |
| XLogP | 5.36 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.97 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |