C19H19IN2O — CID 6961631
(4S)-4-(2-iodophenyl)-2,7,7-trimethyl-5-oxo-3,4,6,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 6961631) has the molecular formula C19H19IN2O and a molecular weight of 418.28 g/mol. Its IUPAC name is (4S)-4-(2-iodophenyl)-2,7,7-trimethyl-5-oxo-3,4,6,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | (4S)-4-(2-iodophenyl)-2,7,7-trimethyl-5-oxo-3,4,6,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 6961631 |
| Molecular Formula | C19H19IN2O |
| Molecular Weight | 418.28 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | (4S)-4-(2-iodophenyl)-2,7,7-trimethyl-5-oxo-3,4,6,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | CC1=NC2=C(C(=O)CC(C)(C)C2)[C@@H](c2ccccc2I)C1C#N |
| InChI | InChI=1S/C19H19IN2O/c1-11-13(10-21)17(12-6-4-5-7-14(12)20)18-15(22-11)8-19(2,3)9-16(18)23/h4-7,13,17H,8-9H2,1-3H3/t13?,17-/m0/s1 |
| InChIKey | FFHLEGOTPVRXMO-RUINGEJQSA-N |
| XLogP | 4.63 |
| TPSA | 53.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.28 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|