C14H13ClCrO7 — CID 11485819
carbon monoxide;2-(2-chloro-3,5-dimethoxyphenyl)-1,3-dioxolane;chromium (PubChem CID 11485819) has the molecular formula C14H13ClCrO7 and a molecular weight of 380.70 g/mol. Its IUPAC name is carbon monoxide;2-(2-chloro-3,5-dimethoxyphenyl)-1,3-dioxolane;chromium.
| Compound Name | carbon monoxide;2-(2-chloro-3,5-dimethoxyphenyl)-1,3-dioxolane;chromium |
|---|---|
| PubChem CID | 11485819 |
| Molecular Formula | C14H13ClCrO7 |
| Molecular Weight | 380.70 g/mol |
| Exact Mass | 379.98 |
| IUPAC Name | carbon monoxide;2-(2-chloro-3,5-dimethoxyphenyl)-1,3-dioxolane;chromium |
| SMILES | COc1cc(OC)c(Cl)c(C2OCCO2)c1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Cr] |
| InChI | InChI=1S/C11H13ClO4.3CO.Cr/c1-13-7-5-8(11-15-3-4-16-11)10(12)9(6-7)14-2;3*1-2;/h5-6,11H,3-4H2,1-2H3;;;; |
| InChIKey | WUNSZEMRLQACNU-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 96.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.70 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|