C8H8BClF3O2- — CID 167721769
(2-chloro-3,5-dimethoxyphenyl)-trifluoroboranuide (PubChem CID 167721769) has the molecular formula C8H8BClF3O2- and a molecular weight of 239.41 g/mol. Its IUPAC name is (2-chloro-3,5-dimethoxyphenyl)-trifluoroboranuide.
| Compound Name | (2-chloro-3,5-dimethoxyphenyl)-trifluoroboranuide |
|---|---|
| PubChem CID | 167721769 |
| Molecular Formula | C8H8BClF3O2- |
| Molecular Weight | 239.41 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | (2-chloro-3,5-dimethoxyphenyl)-trifluoroboranuide |
| SMILES | COc1cc(OC)c(Cl)c([B-](F)(F)F)c1 |
| InChI | InChI=1S/C8H8BClF3O2/c1-14-5-3-6(9(11,12)13)8(10)7(4-5)15-2/h3-4H,1-2H3/q-1 |
| InChIKey | ABXJYVXYWYXHSB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.41 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|