C9H12ClO3P — CID 151134110
chloro-(2,4,6-trimethoxyphenyl)phosphane (PubChem CID 151134110) has the molecular formula C9H12ClO3P and a molecular weight of 234.62 g/mol. Its IUPAC name is chloro-(2,4,6-trimethoxyphenyl)phosphane.
| Compound Name | chloro-(2,4,6-trimethoxyphenyl)phosphane |
|---|---|
| PubChem CID | 151134110 |
| Molecular Formula | C9H12ClO3P |
| Molecular Weight | 234.62 g/mol |
| Exact Mass | 234.02 |
| IUPAC Name | chloro-(2,4,6-trimethoxyphenyl)phosphane |
| SMILES | COc1cc(OC)c(PCl)c(OC)c1 |
| InChI | InChI=1S/C9H12ClO3P/c1-11-6-4-7(12-2)9(14-10)8(5-6)13-3/h4-5,14H,1-3H3 |
| InChIKey | MUVOZXCZSHDRGM-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.62 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|