C8H10ClNO3 — CID 21018373
2-(chloroamino)-3,5-dimethoxyphenol (PubChem CID 21018373) has the molecular formula C8H10ClNO3 and a molecular weight of 203.62 g/mol. Its IUPAC name is 2-(chloroamino)-3,5-dimethoxyphenol.
| Compound Name | 2-(chloroamino)-3,5-dimethoxyphenol |
|---|---|
| PubChem CID | 21018373 |
| Molecular Formula | C8H10ClNO3 |
| Molecular Weight | 203.62 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | 2-(chloroamino)-3,5-dimethoxyphenol |
| SMILES | COc1cc(O)c(NCl)c(OC)c1 |
| InChI | InChI=1S/C8H10ClNO3/c1-12-5-3-6(11)8(10-9)7(4-5)13-2/h3-4,10-11H,1-2H3 |
| InChIKey | SNWTXDKGAJRGAH-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.62 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|