C12H21NO3P+ — CID 102579914
3-(2,4,6-trimethoxyphenyl)phosphanylpropylazanium (PubChem CID 102579914) has the molecular formula C12H21NO3P+ and a molecular weight of 258.28 g/mol. Its IUPAC name is 3-(2,4,6-trimethoxyphenyl)phosphanylpropylazanium.
| Compound Name | 3-(2,4,6-trimethoxyphenyl)phosphanylpropylazanium |
|---|---|
| PubChem CID | 102579914 |
| Molecular Formula | C12H21NO3P+ |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 3-(2,4,6-trimethoxyphenyl)phosphanylpropylazanium |
| SMILES | COc1cc(OC)c(PCCC[NH3+])c(OC)c1 |
| InChI | InChI=1S/C12H20NO3P/c1-14-9-7-10(15-2)12(11(8-9)16-3)17-6-4-5-13/h7-8,17H,4-6,13H2,1-3H3/p+1 |
| InChIKey | SJIBIKYLZVDOAJ-UHFFFAOYSA-O |
| XLogP | 0.65 |
| TPSA | 55.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|