C11H15NO4 — CID 115222665
2-(2,4,6-trimethoxyanilino)acetaldehyde (PubChem CID 115222665) has the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. Its IUPAC name is 2-(2,4,6-trimethoxyanilino)acetaldehyde.
| Compound Name | 2-(2,4,6-trimethoxyanilino)acetaldehyde |
|---|---|
| PubChem CID | 115222665 |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 2-(2,4,6-trimethoxyanilino)acetaldehyde |
| SMILES | COc1cc(OC)c(NCC=O)c(OC)c1 |
| InChI | InChI=1S/C11H15NO4/c1-14-8-6-9(15-2)11(12-4-5-13)10(7-8)16-3/h5-7,12H,4H2,1-3H3 |
| InChIKey | ZOKWGNCGPTXYAT-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|